C9H14 — CID 145030018
6a-methyl-2,3,3a,6-tetrahydro-1H-pentalene (PubChem CID 145030018) has the molecular formula C9H14 and a molecular weight of 122.21 g/mol. Its IUPAC name is 6a-methyl-2,3,3a,6-tetrahydro-1H-pentalene.
| Compound Name | 6a-methyl-2,3,3a,6-tetrahydro-1H-pentalene |
|---|---|
| PubChem CID | 145030018 |
| Molecular Formula | C9H14 |
| Molecular Weight | 122.21 g/mol |
| Exact Mass | 122.11 |
| IUPAC Name | 6a-methyl-2,3,3a,6-tetrahydro-1H-pentalene |
| SMILES | CC12CC=CC1CCC2 |
| InChI | InChI=1S/C9H14/c1-9-6-2-4-8(9)5-3-7-9/h2,4,8H,3,5-7H2,1H3 |
| InChIKey | CHZUCTNQCUGHOL-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.21 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|