C12H22 — CID 145030082
ethane;4-methyl-2,3,3a,4,5,7a-hexahydro-1H-indene (PubChem CID 145030082) has the molecular formula C12H22 and a molecular weight of 166.31 g/mol. Its IUPAC name is ethane;4-methyl-2,3,3a,4,5,7a-hexahydro-1H-indene.
| Compound Name | ethane;4-methyl-2,3,3a,4,5,7a-hexahydro-1H-indene |
|---|---|
| PubChem CID | 145030082 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | ethane;4-methyl-2,3,3a,4,5,7a-hexahydro-1H-indene |
| SMILES | CC.CC1CC=CC2CCCC12 |
| InChI | InChI=1S/C10H16.C2H6/c1-8-4-2-5-9-6-3-7-10(8)9;1-2/h2,5,8-10H,3-4,6-7H2,1H3;1-2H3 |
| InChIKey | HYTCOSHJUWQIMY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|