About [5-[2-(methylamino)-1,3-thiazol-4-yl]-2,3-dihydroindol-1-yl]-(2-methylphenyl)methanone
[5-[2-(methylamino)-1,3-thiazol-4-yl]-2,3-dihydroindol-1-yl]-(2-methylphenyl)methanone (PubChem CID 1450301) has the molecular formula C20H19N3OS
and a molecular weight of 349.46 g/mol. Its IUPAC name is [5-[2-(methylamino)-1,3-thiazol-4-yl]-2,3-dihydroindol-1-yl]-(2-methylphenyl)methanone.
Molecular Properties
| Compound Name | [5-[2-(methylamino)-1,3-thiazol-4-yl]-2,3-dihydroindol-1-yl]-(2-methylphenyl)methanone |
| PubChem CID | 1450301 |
| Molecular Formula | C20H19N3OS |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | [5-[2-(methylamino)-1,3-thiazol-4-yl]-2,3-dihydroindol-1-yl]-(2-methylphenyl)methanone |
| SMILES | CNc1nc(-c2ccc3c(c2)CCN3C(=O)c2ccccc2C)cs1 |
| InChI | InChI=1S/C20H19N3OS/c1-13-5-3-4-6-16(13)19(24)23-10-9-15-11-14(7-8-18(15)23)17-12-25-20(21-2)22-17/h3-8,11-12H,9-10H2,1-2H3,(H,21,22) |
| InChIKey | PJJGCSOCNPBPPD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-[2-(methylamino)-1,3-thiazol-4-yl]-2,3-dihydroindol-1-yl]-(2-methylphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[2-(methylamino)-1,3-thiazol-4-yl]-2,3-dihydroindol-1-yl]-(2-methylphenyl)methanone?
The IUPAC name of [5-[2-(methylamino)-1,3-thiazol-4-yl]-2,3-dihydroindol-1-yl]-(2-methylphenyl)methanone (CID 1450301) is [5-[2-(methylamino)-1,3-thiazol-4-yl]-2,3-dihydroindol-1-yl]-(2-methylphenyl)methanone.
What is the SMILES notation for [5-[2-(methylamino)-1,3-thiazol-4-yl]-2,3-dihydroindol-1-yl]-(2-methylphenyl)methanone?
The canonical SMILES for [5-[2-(methylamino)-1,3-thiazol-4-yl]-2,3-dihydroindol-1-yl]-(2-methylphenyl)methanone is CNc1nc(-c2ccc3c(c2)CCN3C(=O)c2ccccc2C)cs1.
What is the InChIKey of [5-[2-(methylamino)-1,3-thiazol-4-yl]-2,3-dihydroindol-1-yl]-(2-methylphenyl)methanone?
The InChIKey is PJJGCSOCNPBPPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3OS/c1-13-5-3-4-6-16(13)19(24)23-10-9-15-11-14(7-8-18(15)23)17-12-25-20(21-2)22-17/h3-8,11-12H,9-10H2,1-2H3,(H,21,22).
What are the key properties of [5-[2-(methylamino)-1,3-thiazol-4-yl]-2,3-dihydroindol-1-yl]-(2-methylphenyl)methanone?
[5-[2-(methylamino)-1,3-thiazol-4-yl]-2,3-dihydroindol-1-yl]-(2-methylphenyl)methanone has a molecular weight of 349.46 g/mol, XLogP of 4.36, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[2-(methylamino)-1,3-thiazol-4-yl]-2,3-dihydroindol-1-yl]-(2-methylphenyl)methanone is sourced from PubChem (CID 1450301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).