C24H40O3 — CID 145030195
ethane;(5R)-4-hydroxy-2-methoxy-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one (PubChem CID 145030195) has the molecular formula C24H40O3 and a molecular weight of 376.58 g/mol. Its IUPAC name is ethane;(5R)-4-hydroxy-2-methoxy-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one.
| Compound Name | ethane;(5R)-4-hydroxy-2-methoxy-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 145030195 |
| Molecular Formula | C24H40O3 |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.30 |
| IUPAC Name | ethane;(5R)-4-hydroxy-2-methoxy-5-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclohex-2-en-1-one |
| SMILES | CC.COC1=CC(O)[C@H](C/C=C(\C)CC/C=C(\C)CCC=C(C)C)CC1=O |
| InChI | InChI=1S/C22H34O3.C2H6/c1-16(2)8-6-9-17(3)10-7-11-18(4)12-13-19-14-21(24)22(25-5)15-20(19)23;1-2/h8,10,12,15,19-20,23H,6-7,9,11,13-14H2,1-5H3;1-2H3/b17-10+,18-12+;/t19-,20?;/m1./s1 |
| InChIKey | DPVVQCZKXNTVJA-KTZOIYHKSA-N |
| XLogP | 6.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|