About methyl (2S)-2-ethyl-5,5-dimethoxy-7-oxo-2,6-dihydrooxepine-6-carboxylate
methyl (2S)-2-ethyl-5,5-dimethoxy-7-oxo-2,6-dihydrooxepine-6-carboxylate (PubChem CID 145030216) has the molecular formula C12H18O6
and a molecular weight of 258.27 g/mol. Its IUPAC name is methyl (2S)-2-ethyl-5,5-dimethoxy-7-oxo-2,6-dihydrooxepine-6-carboxylate.
Molecular Properties
| Compound Name | methyl (2S)-2-ethyl-5,5-dimethoxy-7-oxo-2,6-dihydrooxepine-6-carboxylate |
| PubChem CID | 145030216 |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | methyl (2S)-2-ethyl-5,5-dimethoxy-7-oxo-2,6-dihydrooxepine-6-carboxylate |
| SMILES | CC[C@H]1C=CC(OC)(OC)C(C(=O)OC)C(=O)O1 |
| InChI | InChI=1S/C12H18O6/c1-5-8-6-7-12(16-3,17-4)9(10(13)15-2)11(14)18-8/h6-9H,5H2,1-4H3/t8-,9?/m0/s1 |
| InChIKey | MVLLUMIHRUONNE-IENPIDJESA-N |
| XLogP | 0.66 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S)-2-ethyl-5,5-dimethoxy-7-oxo-2,6-dihydrooxepine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-ethyl-5,5-dimethoxy-7-oxo-2,6-dihydrooxepine-6-carboxylate?
The IUPAC name of methyl (2S)-2-ethyl-5,5-dimethoxy-7-oxo-2,6-dihydrooxepine-6-carboxylate (CID 145030216) is methyl (2S)-2-ethyl-5,5-dimethoxy-7-oxo-2,6-dihydrooxepine-6-carboxylate.
What is the SMILES notation for methyl (2S)-2-ethyl-5,5-dimethoxy-7-oxo-2,6-dihydrooxepine-6-carboxylate?
The canonical SMILES for methyl (2S)-2-ethyl-5,5-dimethoxy-7-oxo-2,6-dihydrooxepine-6-carboxylate is CC[C@H]1C=CC(OC)(OC)C(C(=O)OC)C(=O)O1.
What is the InChIKey of methyl (2S)-2-ethyl-5,5-dimethoxy-7-oxo-2,6-dihydrooxepine-6-carboxylate?
The InChIKey is MVLLUMIHRUONNE-IENPIDJESA-N. The full InChI is InChI=1S/C12H18O6/c1-5-8-6-7-12(16-3,17-4)9(10(13)15-2)11(14)18-8/h6-9H,5H2,1-4H3/t8-,9?/m0/s1.
What are the key properties of methyl (2S)-2-ethyl-5,5-dimethoxy-7-oxo-2,6-dihydrooxepine-6-carboxylate?
methyl (2S)-2-ethyl-5,5-dimethoxy-7-oxo-2,6-dihydrooxepine-6-carboxylate has a molecular weight of 258.27 g/mol, XLogP of 0.66, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-ethyl-5,5-dimethoxy-7-oxo-2,6-dihydrooxepine-6-carboxylate is sourced from PubChem (CID 145030216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).