About ethane;7-ethenyl-4-ethyl-N-methylcyclohepta-1,3,6-trien-1-amine
ethane;7-ethenyl-4-ethyl-N-methylcyclohepta-1,3,6-trien-1-amine (PubChem CID 145030276) has the molecular formula C16H29N
and a molecular weight of 235.41 g/mol. Its IUPAC name is ethane;7-ethenyl-4-ethyl-N-methylcyclohepta-1,3,6-trien-1-amine.
Molecular Properties
| Compound Name | ethane;7-ethenyl-4-ethyl-N-methylcyclohepta-1,3,6-trien-1-amine |
| PubChem CID | 145030276 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | ethane;7-ethenyl-4-ethyl-N-methylcyclohepta-1,3,6-trien-1-amine |
| SMILES | C=CC1=CCC(CC)=CC=C1NC.CC.CC |
| InChI | InChI=1S/C12H17N.2C2H6/c1-4-10-6-8-11(5-2)12(13-3)9-7-10;2*1-2/h5,7-9,13H,2,4,6H2,1,3H3;2*1-2H3 |
| InChIKey | ZPRQASJHEJUOFU-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;7-ethenyl-4-ethyl-N-methylcyclohepta-1,3,6-trien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-ethenyl-4-ethyl-N-methylcyclohepta-1,3,6-trien-1-amine?
The IUPAC name of ethane;7-ethenyl-4-ethyl-N-methylcyclohepta-1,3,6-trien-1-amine (CID 145030276) is ethane;7-ethenyl-4-ethyl-N-methylcyclohepta-1,3,6-trien-1-amine.
What is the SMILES notation for ethane;7-ethenyl-4-ethyl-N-methylcyclohepta-1,3,6-trien-1-amine?
The canonical SMILES for ethane;7-ethenyl-4-ethyl-N-methylcyclohepta-1,3,6-trien-1-amine is C=CC1=CCC(CC)=CC=C1NC.CC.CC.
What is the InChIKey of ethane;7-ethenyl-4-ethyl-N-methylcyclohepta-1,3,6-trien-1-amine?
The InChIKey is ZPRQASJHEJUOFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N.2C2H6/c1-4-10-6-8-11(5-2)12(13-3)9-7-10;2*1-2/h5,7-9,13H,2,4,6H2,1,3H3;2*1-2H3.
What are the key properties of ethane;7-ethenyl-4-ethyl-N-methylcyclohepta-1,3,6-trien-1-amine?
ethane;7-ethenyl-4-ethyl-N-methylcyclohepta-1,3,6-trien-1-amine has a molecular weight of 235.41 g/mol, XLogP of 4.99, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-ethenyl-4-ethyl-N-methylcyclohepta-1,3,6-trien-1-amine is sourced from PubChem (CID 145030276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).