About 2-[(6-chloro-1,2-benzoxazol-3-yl)methyl]isoindole-1,3-dione;ethane
2-[(6-chloro-1,2-benzoxazol-3-yl)methyl]isoindole-1,3-dione;ethane (PubChem CID 145030311) has the molecular formula C18H15ClN2O3
and a molecular weight of 342.78 g/mol. Its IUPAC name is 2-[(6-chloro-1,2-benzoxazol-3-yl)methyl]isoindole-1,3-dione;ethane.
Molecular Properties
| Compound Name | 2-[(6-chloro-1,2-benzoxazol-3-yl)methyl]isoindole-1,3-dione;ethane |
| PubChem CID | 145030311 |
| Molecular Formula | C18H15ClN2O3 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 2-[(6-chloro-1,2-benzoxazol-3-yl)methyl]isoindole-1,3-dione;ethane |
| SMILES | CC.O=C1c2ccccc2C(=O)N1Cc1noc2cc(Cl)ccc12 |
| InChI | InChI=1S/C16H9ClN2O3.C2H6/c17-9-5-6-12-13(18-22-14(12)7-9)8-19-15(20)10-3-1-2-4-11(10)16(19)21;1-2/h1-7H,8H2;1-2H3 |
| InChIKey | YEPOIJDKWKNCNB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(6-chloro-1,2-benzoxazol-3-yl)methyl]isoindole-1,3-dione;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-chloro-1,2-benzoxazol-3-yl)methyl]isoindole-1,3-dione;ethane?
The IUPAC name of 2-[(6-chloro-1,2-benzoxazol-3-yl)methyl]isoindole-1,3-dione;ethane (CID 145030311) is 2-[(6-chloro-1,2-benzoxazol-3-yl)methyl]isoindole-1,3-dione;ethane.
What is the SMILES notation for 2-[(6-chloro-1,2-benzoxazol-3-yl)methyl]isoindole-1,3-dione;ethane?
The canonical SMILES for 2-[(6-chloro-1,2-benzoxazol-3-yl)methyl]isoindole-1,3-dione;ethane is CC.O=C1c2ccccc2C(=O)N1Cc1noc2cc(Cl)ccc12.
What is the InChIKey of 2-[(6-chloro-1,2-benzoxazol-3-yl)methyl]isoindole-1,3-dione;ethane?
The InChIKey is YEPOIJDKWKNCNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9ClN2O3.C2H6/c17-9-5-6-12-13(18-22-14(12)7-9)8-19-15(20)10-3-1-2-4-11(10)16(19)21;1-2/h1-7H,8H2;1-2H3.
What are the key properties of 2-[(6-chloro-1,2-benzoxazol-3-yl)methyl]isoindole-1,3-dione;ethane?
2-[(6-chloro-1,2-benzoxazol-3-yl)methyl]isoindole-1,3-dione;ethane has a molecular weight of 342.78 g/mol, XLogP of 4.30, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-chloro-1,2-benzoxazol-3-yl)methyl]isoindole-1,3-dione;ethane is sourced from PubChem (CID 145030311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).