About 6,6-difluoro-5-methylidene-3-[(Z)-prop-1-enyl]oct-1-en-2-amine;propane
6,6-difluoro-5-methylidene-3-[(Z)-prop-1-enyl]oct-1-en-2-amine;propane (PubChem CID 145030852) has the molecular formula C15H27F2N
and a molecular weight of 259.38 g/mol. Its IUPAC name is 6,6-difluoro-5-methylidene-3-[(Z)-prop-1-enyl]oct-1-en-2-amine;propane.
Molecular Properties
| Compound Name | 6,6-difluoro-5-methylidene-3-[(Z)-prop-1-enyl]oct-1-en-2-amine;propane |
| PubChem CID | 145030852 |
| Molecular Formula | C15H27F2N |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | 6,6-difluoro-5-methylidene-3-[(Z)-prop-1-enyl]oct-1-en-2-amine;propane |
| SMILES | C=C(N)C(/C=C\C)CC(=C)C(F)(F)CC.CCC |
| InChI | InChI=1S/C12H19F2N.C3H8/c1-5-7-11(10(4)15)8-9(3)12(13,14)6-2;1-3-2/h5,7,11H,3-4,6,8,15H2,1-2H3;3H2,1-2H3/b7-5-; |
| InChIKey | JRZGJOGNSZNXLF-YJOCEBFMSA-N |
| XLogP | 5.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6,6-difluoro-5-methylidene-3-[(Z)-prop-1-enyl]oct-1-en-2-amine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-difluoro-5-methylidene-3-[(Z)-prop-1-enyl]oct-1-en-2-amine;propane?
The IUPAC name of 6,6-difluoro-5-methylidene-3-[(Z)-prop-1-enyl]oct-1-en-2-amine;propane (CID 145030852) is 6,6-difluoro-5-methylidene-3-[(Z)-prop-1-enyl]oct-1-en-2-amine;propane.
What is the SMILES notation for 6,6-difluoro-5-methylidene-3-[(Z)-prop-1-enyl]oct-1-en-2-amine;propane?
The canonical SMILES for 6,6-difluoro-5-methylidene-3-[(Z)-prop-1-enyl]oct-1-en-2-amine;propane is C=C(N)C(/C=C\C)CC(=C)C(F)(F)CC.CCC.
What is the InChIKey of 6,6-difluoro-5-methylidene-3-[(Z)-prop-1-enyl]oct-1-en-2-amine;propane?
The InChIKey is JRZGJOGNSZNXLF-YJOCEBFMSA-N. The full InChI is InChI=1S/C12H19F2N.C3H8/c1-5-7-11(10(4)15)8-9(3)12(13,14)6-2;1-3-2/h5,7,11H,3-4,6,8,15H2,1-2H3;3H2,1-2H3/b7-5-;.
What are the key properties of 6,6-difluoro-5-methylidene-3-[(Z)-prop-1-enyl]oct-1-en-2-amine;propane?
6,6-difluoro-5-methylidene-3-[(Z)-prop-1-enyl]oct-1-en-2-amine;propane has a molecular weight of 259.38 g/mol, XLogP of 5.06, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-difluoro-5-methylidene-3-[(Z)-prop-1-enyl]oct-1-en-2-amine;propane is sourced from PubChem (CID 145030852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).