C20H28N2O3S — CID 145031457
2-[2-[[amino(methyl)amino]methyl]-5-methoxyphenyl]-5,5-dimethyl-3,4,6,7-tetrahydro-2H-1-benzothiophene-3-carboxylic acid (PubChem CID 145031457) has the molecular formula C20H28N2O3S and a molecular weight of 376.52 g/mol. Its IUPAC name is 2-[2-[[amino(methyl)amino]methyl]-5-methoxyphenyl]-5,5-dimethyl-3,4,6,7-tetrahydro-2H-1-benzothiophene-3-carboxylic acid.
| Compound Name | 2-[2-[[amino(methyl)amino]methyl]-5-methoxyphenyl]-5,5-dimethyl-3,4,6,7-tetrahydro-2H-1-benzothiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 145031457 |
| Molecular Formula | C20H28N2O3S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 2-[2-[[amino(methyl)amino]methyl]-5-methoxyphenyl]-5,5-dimethyl-3,4,6,7-tetrahydro-2H-1-benzothiophene-3-carboxylic acid |
| SMILES | COc1ccc(CN(C)N)c(C2SC3=C(CC(C)(C)CC3)C2C(=O)O)c1 |
| InChI | InChI=1S/C20H28N2O3S/c1-20(2)8-7-16-15(10-20)17(19(23)24)18(26-16)14-9-13(25-4)6-5-12(14)11-22(3)21/h5-6,9,17-18H,7-8,10-11,21H2,1-4H3,(H,23,24) |
| InChIKey | VVROKIXOLPDXTH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|