C22H24N2O4 — CID 145032367
8-[(1S,5R,6R)-1,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-4-hydroxy-5-methyl-2-oxo-5,6-dihydro-1H-benzo[h]quinoline-3-carboxylic acid (PubChem CID 145032367) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 8-[(1S,5R,6R)-1,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-4-hydroxy-5-methyl-2-oxo-5,6-dihydro-1H-benzo[h]quinoline-3-carboxylic acid.
| Compound Name | 8-[(1S,5R,6R)-1,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-4-hydroxy-5-methyl-2-oxo-5,6-dihydro-1H-benzo[h]quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 145032367 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 8-[(1S,5R,6R)-1,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-4-hydroxy-5-methyl-2-oxo-5,6-dihydro-1H-benzo[h]quinoline-3-carboxylic acid |
| SMILES | CC1Cc2cc(N3C[C@@H]4[C@@H](C)[C@]4(C)C3)ccc2-c2[nH]c(=O)c(C(=O)O)c(O)c21 |
| InChI | InChI=1S/C22H24N2O4/c1-10-6-12-7-13(24-8-15-11(2)22(15,3)9-24)4-5-14(12)18-16(10)19(25)17(21(27)28)20(26)23-18/h4-5,7,10-11,15H,6,8-9H2,1-3H3,(H,27,28)(H2,23,25,26)/t10?,11-,15-,22+/m1/s1 |
| InChIKey | XPAQLKRUULTPKR-IPVUPRCJSA-N |
| XLogP | 3.20 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |