C29H23F2N3O2S — CID 145032659
1-[1-[3-(1-benzofuran-3-yl)-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl]-3-(2-methylphenyl)sulfanylurea (PubChem CID 145032659) has the molecular formula C29H23F2N3O2S and a molecular weight of 515.59 g/mol. Its IUPAC name is 1-[1-[3-(1-benzofuran-3-yl)-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl]-3-(2-methylphenyl)sulfanylurea.
| Compound Name | 1-[1-[3-(1-benzofuran-3-yl)-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl]-3-(2-methylphenyl)sulfanylurea |
|---|---|
| PubChem CID | 145032659 |
| Molecular Formula | C29H23F2N3O2S |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | 1-[1-[3-(1-benzofuran-3-yl)-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl]-3-(2-methylphenyl)sulfanylurea |
| SMILES | Cc1ccccc1SNC(=O)NC(Cc1cc(F)cc(F)c1)c1ncccc1-c1coc2ccccc12 |
| InChI | InChI=1S/C29H23F2N3O2S/c1-18-7-2-5-11-27(18)37-34-29(35)33-25(15-19-13-20(30)16-21(31)14-19)28-23(9-6-12-32-28)24-17-36-26-10-4-3-8-22(24)26/h2-14,16-17,25H,15H2,1H3,(H2,33,34,35) |
| InChIKey | JQAQMHXKDFVONP-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|