C25H16F2N8 — CID 145033641
8-fluoro-6-[5-(4-fluorophenyl)-1,4-dihydropyrido[4,3-d]pyrimidin-2-yl]-9-pyrimidin-5-yl-2,5,10-triazatricyclo[5.4.0.02,4]undeca-1(11),5,7,9-tetraene (PubChem CID 145033641) has the molecular formula C25H16F2N8 and a molecular weight of 466.46 g/mol. Its IUPAC name is 8-fluoro-6-[5-(4-fluorophenyl)-1,4-dihydropyrido[4,3-d]pyrimidin-2-yl]-9-pyrimidin-5-yl-2,5,10-triazatricyclo[5.4.0.02,4]undeca-1(11),5,7,9-tetraene.
| Compound Name | 8-fluoro-6-[5-(4-fluorophenyl)-1,4-dihydropyrido[4,3-d]pyrimidin-2-yl]-9-pyrimidin-5-yl-2,5,10-triazatricyclo[5.4.0.02,4]undeca-1(11),5,7,9-tetraene |
|---|---|
| PubChem CID | 145033641 |
| Molecular Formula | C25H16F2N8 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | 8-fluoro-6-[5-(4-fluorophenyl)-1,4-dihydropyrido[4,3-d]pyrimidin-2-yl]-9-pyrimidin-5-yl-2,5,10-triazatricyclo[5.4.0.02,4]undeca-1(11),5,7,9-tetraene |
| SMILES | Fc1ccc(-c2nccc3c2CN=C(C2=NC4CN4c4cnc(-c5cncnc5)c(F)c42)N3)cc1 |
| InChI | InChI=1S/C25H16F2N8/c26-15-3-1-13(2-4-15)22-16-9-32-25(33-17(16)5-6-30-22)24-20-18(35-11-19(35)34-24)10-31-23(21(20)27)14-7-28-12-29-8-14/h1-8,10,12,19H,9,11H2,(H,32,33) |
| InChIKey | HLSWOUUJJIGDLD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|