C35H36FN5 — CID 145033728
(2E,4E,6Z,8E)-1-N-benzyl-2-ethenyl-4-ethylidene-7-[[4-(4-fluorophenyl)-1H-imidazo[4,5-c]pyridin-2-yl]methyl]-5-methylidenedeca-2,6,8-triene-1,8-diamine (PubChem CID 145033728) has the molecular formula C35H36FN5 and a molecular weight of 545.71 g/mol. Its IUPAC name is (2E,4E,6Z,8E)-1-N-benzyl-2-ethenyl-4-ethylidene-7-[[4-(4-fluorophenyl)-1H-imidazo[4,5-c]pyridin-2-yl]methyl]-5-methylidenedeca-2,6,8-triene-1,8-diamine.
| Compound Name | (2E,4E,6Z,8E)-1-N-benzyl-2-ethenyl-4-ethylidene-7-[[4-(4-fluorophenyl)-1H-imidazo[4,5-c]pyridin-2-yl]methyl]-5-methylidenedeca-2,6,8-triene-1,8-diamine |
|---|---|
| PubChem CID | 145033728 |
| Molecular Formula | C35H36FN5 |
| Molecular Weight | 545.71 g/mol |
| Exact Mass | 545.30 |
| IUPAC Name | (2E,4E,6Z,8E)-1-N-benzyl-2-ethenyl-4-ethylidene-7-[[4-(4-fluorophenyl)-1H-imidazo[4,5-c]pyridin-2-yl]methyl]-5-methylidenedeca-2,6,8-triene-1,8-diamine |
| SMILES | C=C/C(=C\C(=C/C)C(=C)/C=C(Cc1nc2c(-c3ccc(F)cc3)nccc2[nH]1)/C(N)=C\C)CNCc1ccccc1 |
| InChI | InChI=1S/C35H36FN5/c1-5-25(22-38-23-26-11-9-8-10-12-26)20-27(6-2)24(4)19-29(31(37)7-3)21-33-40-32-17-18-39-34(35(32)41-33)28-13-15-30(36)16-14-28/h5-20,38H,1,4,21-23,37H2,2-3H3,(H,40,41)/b25-20+,27-6+,29-19-,31-7+ |
| InChIKey | OYXGUKXSLRDGEF-YTOXAZTGSA-N |
| XLogP | 7.50 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.71 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|