C34H43FN8 — CID 145035256
(2E,4E)-N-[1-[5-[5-[(cyclopentylmethylamino)methyl]-3-pyridinyl]-4-fluoro-1H-pyrazolo[3,4-c]pyridin-3-yl]ethenyl]-3-methyl-4-(4-methylimidazol-1-yl)hepta-2,4,6-trien-2-amine;ethane (PubChem CID 145035256) has the molecular formula C34H43FN8 and a molecular weight of 582.77 g/mol. Its IUPAC name is (2E,4E)-N-[1-[5-[5-[(cyclopentylmethylamino)methyl]-3-pyridinyl]-4-fluoro-1H-pyrazolo[3,4-c]pyridin-3-yl]ethenyl]-3-methyl-4-(4-methylimidazol-1-yl)hepta-2,4,6-trien-2-amine;ethane.
| Compound Name | (2E,4E)-N-[1-[5-[5-[(cyclopentylmethylamino)methyl]-3-pyridinyl]-4-fluoro-1H-pyrazolo[3,4-c]pyridin-3-yl]ethenyl]-3-methyl-4-(4-methylimidazol-1-yl)hepta-2,4,6-trien-2-amine;ethane |
|---|---|
| PubChem CID | 145035256 |
| Molecular Formula | C34H43FN8 |
| Molecular Weight | 582.77 g/mol |
| Exact Mass | 582.36 |
| IUPAC Name | (2E,4E)-N-[1-[5-[5-[(cyclopentylmethylamino)methyl]-3-pyridinyl]-4-fluoro-1H-pyrazolo[3,4-c]pyridin-3-yl]ethenyl]-3-methyl-4-(4-methylimidazol-1-yl)hepta-2,4,6-trien-2-amine;ethane |
| SMILES | C=C/C=C(C(\C)=C(/C)NC(=C)c1n[nH]c2cnc(-c3cncc(CNCC4CCCC4)c3)c(F)c12)/n1cnc(C)c1.CC |
| InChI | InChI=1S/C32H37FN8.C2H6/c1-6-9-28(41-18-20(2)37-19-41)21(3)22(4)38-23(5)31-29-27(39-40-31)17-36-32(30(29)33)26-12-25(15-35-16-26)14-34-13-24-10-7-8-11-24;1-2/h6,9,12,15-19,24,34,38H,1,5,7-8,10-11,13-14H2,2-4H3,(H,39,40);1-2H3/b22-21+,28-9+; |
| InChIKey | IKERSMWGGSMFNA-DMGWLQBRSA-N |
| XLogP | 7.55 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.77 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|