C29H28FN7S — CID 145037212
3-[7-(5-fluorothiophen-2-yl)-3H-imidazo[4,5-c]pyridin-2-yl]-5-[(2E,4Z)-5-(piperidin-4-ylmethyl)hepta-2,4,6-trien-3-yl]-1H-pyrazolo[3,4-c]pyridine (PubChem CID 145037212) has the molecular formula C29H28FN7S and a molecular weight of 525.66 g/mol. Its IUPAC name is 3-[7-(5-fluorothiophen-2-yl)-3H-imidazo[4,5-c]pyridin-2-yl]-5-[(2E,4Z)-5-(piperidin-4-ylmethyl)hepta-2,4,6-trien-3-yl]-1H-pyrazolo[3,4-c]pyridine.
| Compound Name | 3-[7-(5-fluorothiophen-2-yl)-3H-imidazo[4,5-c]pyridin-2-yl]-5-[(2E,4Z)-5-(piperidin-4-ylmethyl)hepta-2,4,6-trien-3-yl]-1H-pyrazolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 145037212 |
| Molecular Formula | C29H28FN7S |
| Molecular Weight | 525.66 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | 3-[7-(5-fluorothiophen-2-yl)-3H-imidazo[4,5-c]pyridin-2-yl]-5-[(2E,4Z)-5-(piperidin-4-ylmethyl)hepta-2,4,6-trien-3-yl]-1H-pyrazolo[3,4-c]pyridine |
| SMILES | C=C/C(=C\C(=C/C)c1cc2c(-c3nc4c(-c5ccc(F)s5)cncc4[nH]3)n[nH]c2cn1)CC1CCNCC1 |
| InChI | InChI=1S/C29H28FN7S/c1-3-17(11-18-7-9-31-10-8-18)12-19(4-2)22-13-20-23(16-33-22)36-37-28(20)29-34-24-15-32-14-21(27(24)35-29)25-5-6-26(30)38-25/h3-6,12-16,18,31H,1,7-11H2,2H3,(H,34,35)(H,36,37)/b17-12+,19-4+ |
| InChIKey | IFPAPZIKJSCEER-MJFARFIBSA-N |
| XLogP | 6.67 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.66 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|