About 4-bromopyridine-2,3,6-triamine;4-chloroaniline
4-bromopyridine-2,3,6-triamine;4-chloroaniline (PubChem CID 145039491) has the molecular formula C11H13BrClN5
and a molecular weight of 330.62 g/mol. Its IUPAC name is 4-bromopyridine-2,3,6-triamine;4-chloroaniline.
Molecular Properties
| Compound Name | 4-bromopyridine-2,3,6-triamine;4-chloroaniline |
| PubChem CID | 145039491 |
| Molecular Formula | C11H13BrClN5 |
| Molecular Weight | 330.62 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | 4-bromopyridine-2,3,6-triamine;4-chloroaniline |
| SMILES | Nc1cc(Br)c(N)c(N)n1.Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C6H6ClN.C5H7BrN4/c7-5-1-3-6(8)4-2-5;6-2-1-3(7)10-5(9)4(2)8/h1-4H,8H2;1H,8H2,(H4,7,9,10) |
| InChIKey | HRRNSCVTSHDVDV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 116.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.62 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-bromopyridine-2,3,6-triamine;4-chloroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromopyridine-2,3,6-triamine;4-chloroaniline?
The IUPAC name of 4-bromopyridine-2,3,6-triamine;4-chloroaniline (CID 145039491) is 4-bromopyridine-2,3,6-triamine;4-chloroaniline.
What is the SMILES notation for 4-bromopyridine-2,3,6-triamine;4-chloroaniline?
The canonical SMILES for 4-bromopyridine-2,3,6-triamine;4-chloroaniline is Nc1cc(Br)c(N)c(N)n1.Nc1ccc(Cl)cc1.
What is the InChIKey of 4-bromopyridine-2,3,6-triamine;4-chloroaniline?
The InChIKey is HRRNSCVTSHDVDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClN.C5H7BrN4/c7-5-1-3-6(8)4-2-5;6-2-1-3(7)10-5(9)4(2)8/h1-4H,8H2;1H,8H2,(H4,7,9,10).
What are the key properties of 4-bromopyridine-2,3,6-triamine;4-chloroaniline?
4-bromopyridine-2,3,6-triamine;4-chloroaniline has a molecular weight of 330.62 g/mol, XLogP of 2.51, 0 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromopyridine-2,3,6-triamine;4-chloroaniline is sourced from PubChem (CID 145039491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).