About 2,3-diiminobutan-1-ol
2,3-diiminobutan-1-ol (PubChem CID 145039508) has the molecular formula C4H8N2O
and a molecular weight of 100.12 g/mol. Its IUPAC name is 2,3-diiminobutan-1-ol.
Molecular Properties
| Compound Name | 2,3-diiminobutan-1-ol |
| PubChem CID | 145039508 |
| Molecular Formula | C4H8N2O |
| Molecular Weight | 100.12 g/mol |
| Exact Mass | 100.06 |
| IUPAC Name | 2,3-diiminobutan-1-ol |
| SMILES | [H]/N=C(CO)/C(C)=N/[H] |
| InChI | InChI=1S/C4H8N2O/c1-3(5)4(6)2-7/h5-7H,2H2,1H3/b5-3+,6-4+ |
| InChIKey | FOZGDLPXVGBLOY-GGWOSOGESA-N |
| XLogP | 0.04 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.12 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2,3-diiminobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diiminobutan-1-ol?
The IUPAC name of 2,3-diiminobutan-1-ol (CID 145039508) is 2,3-diiminobutan-1-ol.
What is the SMILES notation for 2,3-diiminobutan-1-ol?
The canonical SMILES for 2,3-diiminobutan-1-ol is [H]/N=C(CO)/C(C)=N/[H].
What is the InChIKey of 2,3-diiminobutan-1-ol?
The InChIKey is FOZGDLPXVGBLOY-GGWOSOGESA-N. The full InChI is InChI=1S/C4H8N2O/c1-3(5)4(6)2-7/h5-7H,2H2,1H3/b5-3+,6-4+.
What are the key properties of 2,3-diiminobutan-1-ol?
2,3-diiminobutan-1-ol has a molecular weight of 100.12 g/mol, XLogP of 0.04, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diiminobutan-1-ol is sourced from PubChem (CID 145039508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).