About 4,5,6-tribromo-2,3-bis(methylsulfanyl)-1H-indole
4,5,6-tribromo-2,3-bis(methylsulfanyl)-1H-indole (PubChem CID 14503989) has the molecular formula C10H8Br3NS2
and a molecular weight of 446.03 g/mol. Its IUPAC name is 4,5,6-tribromo-2,3-bis(methylsulfanyl)-1H-indole.
Molecular Properties
| Compound Name | 4,5,6-tribromo-2,3-bis(methylsulfanyl)-1H-indole |
| PubChem CID | 14503989 |
| Molecular Formula | C10H8Br3NS2 |
| Molecular Weight | 446.03 g/mol |
| Exact Mass | 442.76 |
| IUPAC Name | 4,5,6-tribromo-2,3-bis(methylsulfanyl)-1H-indole |
| SMILES | CSc1[nH]c2cc(Br)c(Br)c(Br)c2c1SC |
| InChI | InChI=1S/C10H8Br3NS2/c1-15-9-6-5(14-10(9)16-2)3-4(11)7(12)8(6)13/h3,14H,1-2H3 |
| InChIKey | KHYRMWFKXMLZCD-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.03 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 4,5,6-tribromo-2,3-bis(methylsulfanyl)-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5,6-tribromo-2,3-bis(methylsulfanyl)-1H-indole?
The IUPAC name of 4,5,6-tribromo-2,3-bis(methylsulfanyl)-1H-indole (CID 14503989) is 4,5,6-tribromo-2,3-bis(methylsulfanyl)-1H-indole.
What is the SMILES notation for 4,5,6-tribromo-2,3-bis(methylsulfanyl)-1H-indole?
The canonical SMILES for 4,5,6-tribromo-2,3-bis(methylsulfanyl)-1H-indole is CSc1[nH]c2cc(Br)c(Br)c(Br)c2c1SC.
What is the InChIKey of 4,5,6-tribromo-2,3-bis(methylsulfanyl)-1H-indole?
The InChIKey is KHYRMWFKXMLZCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8Br3NS2/c1-15-9-6-5(14-10(9)16-2)3-4(11)7(12)8(6)13/h3,14H,1-2H3.
What are the key properties of 4,5,6-tribromo-2,3-bis(methylsulfanyl)-1H-indole?
4,5,6-tribromo-2,3-bis(methylsulfanyl)-1H-indole has a molecular weight of 446.03 g/mol, XLogP of 5.90, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5,6-tribromo-2,3-bis(methylsulfanyl)-1H-indole is sourced from PubChem (CID 14503989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).