C35H41N3O8S2 — CID 145040803
2-(disulfanyl)propyl 6-hydroxy-3-[6-(5-hydroxy-1,2-dihydrobenzo[e]indol-3-yl)-6-oxohexoxy]-2-methoxy-11-oxo-6a,7,8,9-tetrahydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate (PubChem CID 145040803) has the molecular formula C35H41N3O8S2 and a molecular weight of 695.86 g/mol. Its IUPAC name is 2-(disulfanyl)propyl 6-hydroxy-3-[6-(5-hydroxy-1,2-dihydrobenzo[e]indol-3-yl)-6-oxohexoxy]-2-methoxy-11-oxo-6a,7,8,9-tetrahydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate.
| Compound Name | 2-(disulfanyl)propyl 6-hydroxy-3-[6-(5-hydroxy-1,2-dihydrobenzo[e]indol-3-yl)-6-oxohexoxy]-2-methoxy-11-oxo-6a,7,8,9-tetrahydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate |
|---|---|
| PubChem CID | 145040803 |
| Molecular Formula | C35H41N3O8S2 |
| Molecular Weight | 695.86 g/mol |
| Exact Mass | 695.23 |
| IUPAC Name | 2-(disulfanyl)propyl 6-hydroxy-3-[6-(5-hydroxy-1,2-dihydrobenzo[e]indol-3-yl)-6-oxohexoxy]-2-methoxy-11-oxo-6a,7,8,9-tetrahydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate |
| SMILES | COc1cc2c(cc1OCCCCCC(=O)N1CCc3c1cc(O)c1ccccc31)N(C(=O)OCC(C)SS)C(O)C1CCCN1C2=O |
| InChI | InChI=1S/C35H41N3O8S2/c1-21(48-47)20-46-35(43)38-28-19-31(30(44-2)17-25(28)33(41)37-14-8-11-26(37)34(38)42)45-16-7-3-4-12-32(40)36-15-13-23-22-9-5-6-10-24(22)29(39)18-27(23)36/h5-6,9-10,17-19,21,26,34,39,42,47H,3-4,7-8,11-16,20H2,1-2H3 |
| InChIKey | UMZMJOWQWDEKIG-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.86 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|