C39H60O11 — CID 145040907
(15E,17E,19E,21E,23E)-13-butan-2-yl-1,3,9,29-tetrahydroxy-25-(5-hydroxyoxan-2-yl)oxy-28-methyl-12,31-dioxabicyclo[25.3.1]hentriaconta-15,17,19,21,23-pentaene-7,11-dione (PubChem CID 145040907) has the molecular formula C39H60O11 and a molecular weight of 704.90 g/mol. Its IUPAC name is (15E,17E,19E,21E,23E)-13-butan-2-yl-1,3,9,29-tetrahydroxy-25-(5-hydroxyoxan-2-yl)oxy-28-methyl-12,31-dioxabicyclo[25.3.1]hentriaconta-15,17,19,21,23-pentaene-7,11-dione.
| Compound Name | (15E,17E,19E,21E,23E)-13-butan-2-yl-1,3,9,29-tetrahydroxy-25-(5-hydroxyoxan-2-yl)oxy-28-methyl-12,31-dioxabicyclo[25.3.1]hentriaconta-15,17,19,21,23-pentaene-7,11-dione |
|---|---|
| PubChem CID | 145040907 |
| Molecular Formula | C39H60O11 |
| Molecular Weight | 704.90 g/mol |
| Exact Mass | 704.41 |
| IUPAC Name | (15E,17E,19E,21E,23E)-13-butan-2-yl-1,3,9,29-tetrahydroxy-25-(5-hydroxyoxan-2-yl)oxy-28-methyl-12,31-dioxabicyclo[25.3.1]hentriaconta-15,17,19,21,23-pentaene-7,11-dione |
| SMILES | CCC(C)C1C/C=C\C=C\C=C\C=C\C=C\C(OC2CCC(O)CO2)CC2OC(O)(CC(O)CCCC(=O)CC(O)CC(=O)O1)CC(O)C2C |
| InChI | InChI=1S/C39H60O11/c1-4-27(2)35-18-13-11-9-7-5-6-8-10-12-17-33(48-38-20-19-31(42)26-47-38)23-36-28(3)34(44)25-39(46,50-36)24-30(41)16-14-15-29(40)21-32(43)22-37(45)49-35/h5-13,17,27-28,30-36,38,41-44,46H,4,14-16,18-26H2,1-3H3/b6-5+,9-7+,10-8+,13-11-,17-12+ |
| InChIKey | KQWIVJBWVGAWRK-RHJACKIOSA-N |
| XLogP | 4.51 |
| TPSA | 172.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.90 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |