C24H27N3OS — CID 145041417
(E)-2-cyano-3-[5-[(4Z)-4-[2-(diethylamino)but-2-enylidene]-3-methylidenecyclohexa-1,5-dien-1-yl]thiophen-2-yl]but-2-enamide (PubChem CID 145041417) has the molecular formula C24H27N3OS and a molecular weight of 405.57 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[(4Z)-4-[2-(diethylamino)but-2-enylidene]-3-methylidenecyclohexa-1,5-dien-1-yl]thiophen-2-yl]but-2-enamide.
| Compound Name | (E)-2-cyano-3-[5-[(4Z)-4-[2-(diethylamino)but-2-enylidene]-3-methylidenecyclohexa-1,5-dien-1-yl]thiophen-2-yl]but-2-enamide |
|---|---|
| PubChem CID | 145041417 |
| Molecular Formula | C24H27N3OS |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | (E)-2-cyano-3-[5-[(4Z)-4-[2-(diethylamino)but-2-enylidene]-3-methylidenecyclohexa-1,5-dien-1-yl]thiophen-2-yl]but-2-enamide |
| SMILES | C=c1cc(-c2ccc(/C(C)=C(\C#N)C(N)=O)s2)cc/c1=C/C(=CC)N(CC)CC |
| InChI | InChI=1S/C24H27N3OS/c1-6-20(27(7-2)8-3)14-18-9-10-19(13-16(18)4)23-12-11-22(29-23)17(5)21(15-25)24(26)28/h6,9-14H,4,7-8H2,1-3,5H3,(H2,26,28)/b18-14-,20-6?,21-17+ |
| InChIKey | PTJRJBVFBVWIMQ-WHZIIHIOSA-N |
| XLogP | 3.63 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|