About (2S,3E)-3-ethenyl-1-methoxy-N-prop-1-en-2-ylhexa-3,5-dien-2-amine
(2S,3E)-3-ethenyl-1-methoxy-N-prop-1-en-2-ylhexa-3,5-dien-2-amine (PubChem CID 145041866) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is (2S,3E)-3-ethenyl-1-methoxy-N-prop-1-en-2-ylhexa-3,5-dien-2-amine.
Molecular Properties
| Compound Name | (2S,3E)-3-ethenyl-1-methoxy-N-prop-1-en-2-ylhexa-3,5-dien-2-amine |
| PubChem CID | 145041866 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (2S,3E)-3-ethenyl-1-methoxy-N-prop-1-en-2-ylhexa-3,5-dien-2-amine |
| SMILES | C=C/C=C(\C=C)[C@@H](COC)NC(=C)C |
| InChI | InChI=1S/C12H19NO/c1-6-8-11(7-2)12(9-14-5)13-10(3)4/h6-8,12-13H,1-3,9H2,4-5H3/b11-8+/t12-/m1/s1 |
| InChIKey | MOSWBOQEKXZJBL-JATZPVMKSA-N |
| XLogP | 2.42 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2S,3E)-3-ethenyl-1-methoxy-N-prop-1-en-2-ylhexa-3,5-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3E)-3-ethenyl-1-methoxy-N-prop-1-en-2-ylhexa-3,5-dien-2-amine?
The IUPAC name of (2S,3E)-3-ethenyl-1-methoxy-N-prop-1-en-2-ylhexa-3,5-dien-2-amine (CID 145041866) is (2S,3E)-3-ethenyl-1-methoxy-N-prop-1-en-2-ylhexa-3,5-dien-2-amine.
What is the SMILES notation for (2S,3E)-3-ethenyl-1-methoxy-N-prop-1-en-2-ylhexa-3,5-dien-2-amine?
The canonical SMILES for (2S,3E)-3-ethenyl-1-methoxy-N-prop-1-en-2-ylhexa-3,5-dien-2-amine is C=C/C=C(\C=C)[C@@H](COC)NC(=C)C.
What is the InChIKey of (2S,3E)-3-ethenyl-1-methoxy-N-prop-1-en-2-ylhexa-3,5-dien-2-amine?
The InChIKey is MOSWBOQEKXZJBL-JATZPVMKSA-N. The full InChI is InChI=1S/C12H19NO/c1-6-8-11(7-2)12(9-14-5)13-10(3)4/h6-8,12-13H,1-3,9H2,4-5H3/b11-8+/t12-/m1/s1.
What are the key properties of (2S,3E)-3-ethenyl-1-methoxy-N-prop-1-en-2-ylhexa-3,5-dien-2-amine?
(2S,3E)-3-ethenyl-1-methoxy-N-prop-1-en-2-ylhexa-3,5-dien-2-amine has a molecular weight of 193.29 g/mol, XLogP of 2.42, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3E)-3-ethenyl-1-methoxy-N-prop-1-en-2-ylhexa-3,5-dien-2-amine is sourced from PubChem (CID 145041866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).