C25H47N — CID 145042712
ethane;(2E)-2-ethylidene-N-[(3Z,4Z)-3-(2-methylpropylidene)hepta-4,6-dienyl]hex-5-en-1-imine (PubChem CID 145042712) has the molecular formula C25H47N and a molecular weight of 361.66 g/mol. Its IUPAC name is ethane;(2E)-2-ethylidene-N-[(3Z,4Z)-3-(2-methylpropylidene)hepta-4,6-dienyl]hex-5-en-1-imine.
| Compound Name | ethane;(2E)-2-ethylidene-N-[(3Z,4Z)-3-(2-methylpropylidene)hepta-4,6-dienyl]hex-5-en-1-imine |
|---|---|
| PubChem CID | 145042712 |
| Molecular Formula | C25H47N |
| Molecular Weight | 361.66 g/mol |
| Exact Mass | 361.37 |
| IUPAC Name | ethane;(2E)-2-ethylidene-N-[(3Z,4Z)-3-(2-methylpropylidene)hepta-4,6-dienyl]hex-5-en-1-imine |
| SMILES | C=C/C=C\C(=C/C(C)C)CC/N=C/C(=C/C)CCC=C.CC.CC.CC |
| InChI | InChI=1S/C19H29N.3C2H6/c1-6-9-11-18(8-3)16-20-14-13-19(12-10-7-2)15-17(4)5;3*1-2/h6-8,10,12,15-17H,1-2,9,11,13-14H2,3-5H3;3*1-2H3/b12-10-,18-8+,19-15+,20-16+;;; |
| InChIKey | GKZMWKPLDNNTOI-ZJCZYSPJSA-N |
| XLogP | 8.76 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.66 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|