C32H31ClF2N6O2 — CID 145043288
N-(3-chloro-4-pyridinyl)-6-[1-[[2,6-difluoro-4-(2-methoxyethoxy)phenyl]methyl]indazol-3-yl]-3-piperidin-4-ylpyridin-2-amine (PubChem CID 145043288) has the molecular formula C32H31ClF2N6O2 and a molecular weight of 605.09 g/mol. Its IUPAC name is N-(3-chloro-4-pyridinyl)-6-[1-[[2,6-difluoro-4-(2-methoxyethoxy)phenyl]methyl]indazol-3-yl]-3-piperidin-4-ylpyridin-2-amine.
| Compound Name | N-(3-chloro-4-pyridinyl)-6-[1-[[2,6-difluoro-4-(2-methoxyethoxy)phenyl]methyl]indazol-3-yl]-3-piperidin-4-ylpyridin-2-amine |
|---|---|
| PubChem CID | 145043288 |
| Molecular Formula | C32H31ClF2N6O2 |
| Molecular Weight | 605.09 g/mol |
| Exact Mass | 604.22 |
| IUPAC Name | N-(3-chloro-4-pyridinyl)-6-[1-[[2,6-difluoro-4-(2-methoxyethoxy)phenyl]methyl]indazol-3-yl]-3-piperidin-4-ylpyridin-2-amine |
| SMILES | COCCOc1cc(F)c(Cn2nc(-c3ccc(C4CCNCC4)c(Nc4ccncc4Cl)n3)c3ccccc32)c(F)c1 |
| InChI | InChI=1S/C32H31ClF2N6O2/c1-42-14-15-43-21-16-26(34)24(27(35)17-21)19-41-30-5-3-2-4-23(30)31(40-41)29-7-6-22(20-8-11-36-12-9-20)32(39-29)38-28-10-13-37-18-25(28)33/h2-7,10,13,16-18,20,36H,8-9,11-12,14-15,19H2,1H3,(H,37,38,39) |
| InChIKey | HMWGRCORRGRTNR-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 86.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.09 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|