C36H40F3N5O2 — CID 145043465
6-[2-[(4-ethoxy-2,6-difluorophenyl)methylamino]benzenecarboximidoyl]-N-[(1E,3E,7E)-8-fluoro-6-methylcycloocta-1,3,7-trien-1-yl]-5-methyl-4-(morpholin-4-ylmethyl)pyridin-2-amine (PubChem CID 145043465) has the molecular formula C36H40F3N5O2 and a molecular weight of 631.74 g/mol. Its IUPAC name is 6-[2-[(4-ethoxy-2,6-difluorophenyl)methylamino]benzenecarboximidoyl]-N-[(1E,3E,7E)-8-fluoro-6-methylcycloocta-1,3,7-trien-1-yl]-5-methyl-4-(morpholin-4-ylmethyl)pyridin-2-amine.
| Compound Name | 6-[2-[(4-ethoxy-2,6-difluorophenyl)methylamino]benzenecarboximidoyl]-N-[(1E,3E,7E)-8-fluoro-6-methylcycloocta-1,3,7-trien-1-yl]-5-methyl-4-(morpholin-4-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 145043465 |
| Molecular Formula | C36H40F3N5O2 |
| Molecular Weight | 631.74 g/mol |
| Exact Mass | 631.31 |
| IUPAC Name | 6-[2-[(4-ethoxy-2,6-difluorophenyl)methylamino]benzenecarboximidoyl]-N-[(1E,3E,7E)-8-fluoro-6-methylcycloocta-1,3,7-trien-1-yl]-5-methyl-4-(morpholin-4-ylmethyl)pyridin-2-amine |
| SMILES | [H]/N=C(\c1ccccc1NCc1c(F)cc(OCC)cc1F)c1nc(NC2=C/C=C\CC(C)/C=C\2F)cc(CN2CCOCC2)c1C |
| InChI | InChI=1S/C36H40F3N5O2/c1-4-46-26-19-29(37)28(30(38)20-26)21-41-32-11-8-6-10-27(32)35(40)36-24(3)25(22-44-13-15-45-16-14-44)18-34(43-36)42-33-12-7-5-9-23(2)17-31(33)39/h5-8,10-12,17-20,23,40-41H,4,9,13-16,21-22H2,1-3H3,(H,42,43)/b7-5-,31-17+,33-12+,40-35+ |
| InChIKey | RZIKSMZGJZBQAE-RVXBWISASA-N |
| XLogP | 7.67 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.74 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|