C25H27F2N5O2 — CID 145043483
2-[2-[(4-ethoxy-2,6-difluorophenyl)methylamino]benzenecarboximidoyl]-6-ethyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 145043483) has the molecular formula C25H27F2N5O2 and a molecular weight of 467.52 g/mol. Its IUPAC name is 2-[2-[(4-ethoxy-2,6-difluorophenyl)methylamino]benzenecarboximidoyl]-6-ethyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-[2-[(4-ethoxy-2,6-difluorophenyl)methylamino]benzenecarboximidoyl]-6-ethyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 145043483 |
| Molecular Formula | C25H27F2N5O2 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 2-[2-[(4-ethoxy-2,6-difluorophenyl)methylamino]benzenecarboximidoyl]-6-ethyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | [H]/N=C(/c1nc2c(c(=O)[nH]1)CN(CC)CC2)c1ccccc1NCc1c(F)cc(OCC)cc1F |
| InChI | InChI=1S/C25H27F2N5O2/c1-3-32-10-9-22-18(14-32)25(33)31-24(30-22)23(28)16-7-5-6-8-21(16)29-13-17-19(26)11-15(34-4-2)12-20(17)27/h5-8,11-12,28-29H,3-4,9-10,13-14H2,1-2H3,(H,30,31,33)/b28-23+ |
| InChIKey | GROQSAIZLFIVNI-WEMUOSSPSA-N |
| XLogP | 3.85 |
| TPSA | 94.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|