C24H34FN5 — CID 145043988
1-[(15E)-18-fluoro-6,15-dimethyl-13-[(Z)-prop-1-enyl]-6,9,12,14-tetrazatricyclo[15.3.1.04,9]henicosa-1(21),12,15,17,19-pentaen-16-yl]-N-methylmethanimine (PubChem CID 145043988) has the molecular formula C24H34FN5 and a molecular weight of 411.57 g/mol. Its IUPAC name is 1-[(15E)-18-fluoro-6,15-dimethyl-13-[(Z)-prop-1-enyl]-6,9,12,14-tetrazatricyclo[15.3.1.04,9]henicosa-1(21),12,15,17,19-pentaen-16-yl]-N-methylmethanimine.
| Compound Name | 1-[(15E)-18-fluoro-6,15-dimethyl-13-[(Z)-prop-1-enyl]-6,9,12,14-tetrazatricyclo[15.3.1.04,9]henicosa-1(21),12,15,17,19-pentaen-16-yl]-N-methylmethanimine |
|---|---|
| PubChem CID | 145043988 |
| Molecular Formula | C24H34FN5 |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | 1-[(15E)-18-fluoro-6,15-dimethyl-13-[(Z)-prop-1-enyl]-6,9,12,14-tetrazatricyclo[15.3.1.04,9]henicosa-1(21),12,15,17,19-pentaen-16-yl]-N-methylmethanimine |
| SMILES | C/C=C\C1=N/CCN2CCN(C)CC2CCc2ccc(F)c(c2)C(/C=N/C)=C(/C)N1 |
| InChI | InChI=1S/C24H34FN5/c1-5-6-24-27-11-12-30-14-13-29(4)17-20(30)9-7-19-8-10-23(25)21(15-19)22(16-26-3)18(2)28-24/h5-6,8,10,15-16,20H,7,9,11-14,17H2,1-4H3,(H,27,28)/b6-5-,22-18-,26-16+ |
| InChIKey | GHZRTZQRBQHNHD-NXCNZIMZSA-N |
| XLogP | 3.38 |
| TPSA | 43.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|