C19H30N2O2S — CID 145044070
ethane;ethyl 1,5,5,7,7-pentamethyl-6,8-dihydroimidazo[2,1-b][1,3]benzothiazole-2-carboxylate (PubChem CID 145044070) has the molecular formula C19H30N2O2S and a molecular weight of 350.53 g/mol. Its IUPAC name is ethane;ethyl 1,5,5,7,7-pentamethyl-6,8-dihydroimidazo[2,1-b][1,3]benzothiazole-2-carboxylate.
| Compound Name | ethane;ethyl 1,5,5,7,7-pentamethyl-6,8-dihydroimidazo[2,1-b][1,3]benzothiazole-2-carboxylate |
|---|---|
| PubChem CID | 145044070 |
| Molecular Formula | C19H30N2O2S |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | ethane;ethyl 1,5,5,7,7-pentamethyl-6,8-dihydroimidazo[2,1-b][1,3]benzothiazole-2-carboxylate |
| SMILES | CC.CCOC(=O)c1nc2sc3c(n2c1C)CC(C)(C)CC3(C)C |
| InChI | InChI=1S/C17H24N2O2S.C2H6/c1-7-21-14(20)12-10(2)19-11-8-16(3,4)9-17(5,6)13(11)22-15(19)18-12;1-2/h7-9H2,1-6H3;1-2H3 |
| InChIKey | OHGMMEVXJWFZPK-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |