C18H19FN4 — CID 145044312
2-[6-(6-fluoro-1H-indol-3-yl)-1H-benzimidazol-2-yl]ethanamine;methane (PubChem CID 145044312) has the molecular formula C18H19FN4 and a molecular weight of 310.38 g/mol. Its IUPAC name is 2-[6-(6-fluoro-1H-indol-3-yl)-1H-benzimidazol-2-yl]ethanamine;methane.
| Compound Name | 2-[6-(6-fluoro-1H-indol-3-yl)-1H-benzimidazol-2-yl]ethanamine;methane |
|---|---|
| PubChem CID | 145044312 |
| Molecular Formula | C18H19FN4 |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 2-[6-(6-fluoro-1H-indol-3-yl)-1H-benzimidazol-2-yl]ethanamine;methane |
| SMILES | C.NCCc1nc2ccc(-c3c[nH]c4cc(F)ccc34)cc2[nH]1 |
| InChI | InChI=1S/C17H15FN4.CH4/c18-11-2-3-12-13(9-20-15(12)8-11)10-1-4-14-16(7-10)22-17(21-14)5-6-19;/h1-4,7-9,20H,5-6,19H2,(H,21,22);1H4 |
| InChIKey | JVFGKSRCEUOUEP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 70.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |