C27H40N2 — CID 145044383
2-[cyclohepta-1,3,6-trien-1-yl-(5-methylcyclohepta-1,3,6-trien-1-yl)methyl]-2,9-diazaspiro[5.5]undecane;ethane (PubChem CID 145044383) has the molecular formula C27H40N2 and a molecular weight of 392.63 g/mol. Its IUPAC name is 2-[cyclohepta-1,3,6-trien-1-yl-(5-methylcyclohepta-1,3,6-trien-1-yl)methyl]-2,9-diazaspiro[5.5]undecane;ethane.
| Compound Name | 2-[cyclohepta-1,3,6-trien-1-yl-(5-methylcyclohepta-1,3,6-trien-1-yl)methyl]-2,9-diazaspiro[5.5]undecane;ethane |
|---|---|
| PubChem CID | 145044383 |
| Molecular Formula | C27H40N2 |
| Molecular Weight | 392.63 g/mol |
| Exact Mass | 392.32 |
| IUPAC Name | 2-[cyclohepta-1,3,6-trien-1-yl-(5-methylcyclohepta-1,3,6-trien-1-yl)methyl]-2,9-diazaspiro[5.5]undecane;ethane |
| SMILES | CC.CC1C=CC=C(C(C2=CC=CCC=C2)N2CCCC3(CCNCC3)C2)C=C1 |
| InChI | InChI=1S/C25H34N2.C2H6/c1-21-8-6-11-23(13-12-21)24(22-9-4-2-3-5-10-22)27-19-7-14-25(20-27)15-17-26-18-16-25;1-2/h2,4-6,8-13,21,24,26H,3,7,14-20H2,1H3;1-2H3 |
| InChIKey | HLLVMXBYTHWJIS-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.63 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |