C15H20F2N2O2 — CID 145044417
9-[(2E)-2-ethenylpenta-2,4-dienyl]-2,2-difluoro-1-oxa-4,9-diazaspiro[5.5]undecan-3-one (PubChem CID 145044417) has the molecular formula C15H20F2N2O2 and a molecular weight of 298.33 g/mol. Its IUPAC name is 9-[(2E)-2-ethenylpenta-2,4-dienyl]-2,2-difluoro-1-oxa-4,9-diazaspiro[5.5]undecan-3-one.
| Compound Name | 9-[(2E)-2-ethenylpenta-2,4-dienyl]-2,2-difluoro-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 145044417 |
| Molecular Formula | C15H20F2N2O2 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 9-[(2E)-2-ethenylpenta-2,4-dienyl]-2,2-difluoro-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
| SMILES | C=C/C=C(\C=C)CN1CCC2(CC1)CNC(=O)C(F)(F)O2 |
| InChI | InChI=1S/C15H20F2N2O2/c1-3-5-12(4-2)10-19-8-6-14(7-9-19)11-18-13(20)15(16,17)21-14/h3-5H,1-2,6-11H2,(H,18,20)/b12-5+ |
| InChIKey | ISVHFOQTKKYCJP-LFYBBSHMSA-N |
| XLogP | 1.86 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|