C24H29N3O — CID 145045032
N-[4-[1-[3,4-bis(ethenyl)phenyl]ethoxy]-2,5-dimethylphenyl]-1,4,5,6-tetrahydropyrimidin-2-amine (PubChem CID 145045032) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is N-[4-[1-[3,4-bis(ethenyl)phenyl]ethoxy]-2,5-dimethylphenyl]-1,4,5,6-tetrahydropyrimidin-2-amine.
| Compound Name | N-[4-[1-[3,4-bis(ethenyl)phenyl]ethoxy]-2,5-dimethylphenyl]-1,4,5,6-tetrahydropyrimidin-2-amine |
|---|---|
| PubChem CID | 145045032 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | N-[4-[1-[3,4-bis(ethenyl)phenyl]ethoxy]-2,5-dimethylphenyl]-1,4,5,6-tetrahydropyrimidin-2-amine |
| SMILES | C=Cc1ccc(C(C)Oc2cc(C)c(NC3=NCCCN3)cc2C)cc1C=C |
| InChI | InChI=1S/C24H29N3O/c1-6-19-9-10-21(15-20(19)7-2)18(5)28-23-14-16(3)22(13-17(23)4)27-24-25-11-8-12-26-24/h6-7,9-10,13-15,18H,1-2,8,11-12H2,3-5H3,(H2,25,26,27) |
| InChIKey | XBXLYXJCNNHZHH-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |