C27H31N5S — CID 145045074
4-methyl-2-[2-[(Z)-2-(methylideneamino)-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethenyl]sulfanylethyl]-5-(1,4,5,6-tetrahydropyrimidin-2-ylamino)benzonitrile (PubChem CID 145045074) has the molecular formula C27H31N5S and a molecular weight of 457.65 g/mol. Its IUPAC name is 4-methyl-2-[2-[(Z)-2-(methylideneamino)-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethenyl]sulfanylethyl]-5-(1,4,5,6-tetrahydropyrimidin-2-ylamino)benzonitrile.
| Compound Name | 4-methyl-2-[2-[(Z)-2-(methylideneamino)-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethenyl]sulfanylethyl]-5-(1,4,5,6-tetrahydropyrimidin-2-ylamino)benzonitrile |
|---|---|
| PubChem CID | 145045074 |
| Molecular Formula | C27H31N5S |
| Molecular Weight | 457.65 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | 4-methyl-2-[2-[(Z)-2-(methylideneamino)-2-(5,6,7,8-tetrahydronaphthalen-2-yl)ethenyl]sulfanylethyl]-5-(1,4,5,6-tetrahydropyrimidin-2-ylamino)benzonitrile |
| SMILES | C=N/C(=C\SCCc1cc(C)c(NC2=NCCCN2)cc1C#N)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C27H31N5S/c1-19-14-22(24(17-28)16-25(19)32-27-30-11-5-12-31-27)10-13-33-18-26(29-2)23-9-8-20-6-3-4-7-21(20)15-23/h8-9,14-16,18H,2-7,10-13H2,1H3,(H2,30,31,32)/b26-18- |
| InChIKey | SFRRGBWTRFNVKR-ITYLOYPMSA-N |
| XLogP | 5.48 |
| TPSA | 72.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.65 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|