C26H28F2N4S — CID 145045138
N-[5-(difluoromethyl)-2-methyl-4-[[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-1,4,5,6-tetrahydropyrimidin-2-amine (PubChem CID 145045138) has the molecular formula C26H28F2N4S and a molecular weight of 466.60 g/mol. Its IUPAC name is N-[5-(difluoromethyl)-2-methyl-4-[[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-1,4,5,6-tetrahydropyrimidin-2-amine.
| Compound Name | N-[5-(difluoromethyl)-2-methyl-4-[[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-1,4,5,6-tetrahydropyrimidin-2-amine |
|---|---|
| PubChem CID | 145045138 |
| Molecular Formula | C26H28F2N4S |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | N-[5-(difluoromethyl)-2-methyl-4-[[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]methyl]phenyl]-1,4,5,6-tetrahydropyrimidin-2-amine |
| SMILES | Cc1cc(Cc2nc(-c3ccc4c(c3)CCCC4)cs2)c(C(F)F)cc1NC1=NCCCN1 |
| InChI | InChI=1S/C26H28F2N4S/c1-16-11-20(21(25(27)28)14-22(16)32-26-29-9-4-10-30-26)13-24-31-23(15-33-24)19-8-7-17-5-2-3-6-18(17)12-19/h7-8,11-12,14-15,25H,2-6,9-10,13H2,1H3,(H2,29,30,32) |
| InChIKey | DXFJXIIWCLJFKS-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |