C22H27N5OS — CID 145045171
N'-[[2,5-dimethyl-4-(1,4,5,6-tetrahydropyrimidin-2-ylamino)phenoxy]methylsulfanyl]-3-methyl-N-methylidenebenzenecarboximidamide (PubChem CID 145045171) has the molecular formula C22H27N5OS and a molecular weight of 409.56 g/mol. Its IUPAC name is N'-[[2,5-dimethyl-4-(1,4,5,6-tetrahydropyrimidin-2-ylamino)phenoxy]methylsulfanyl]-3-methyl-N-methylidenebenzenecarboximidamide.
| Compound Name | N'-[[2,5-dimethyl-4-(1,4,5,6-tetrahydropyrimidin-2-ylamino)phenoxy]methylsulfanyl]-3-methyl-N-methylidenebenzenecarboximidamide |
|---|---|
| PubChem CID | 145045171 |
| Molecular Formula | C22H27N5OS |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | N'-[[2,5-dimethyl-4-(1,4,5,6-tetrahydropyrimidin-2-ylamino)phenoxy]methylsulfanyl]-3-methyl-N-methylidenebenzenecarboximidamide |
| SMILES | C=N/C(=N\SCOc1cc(C)c(NC2=NCCCN2)cc1C)c1cccc(C)c1 |
| InChI | InChI=1S/C22H27N5OS/c1-15-7-5-8-18(11-15)21(23-4)27-29-14-28-20-13-16(2)19(12-17(20)3)26-22-24-9-6-10-25-22/h5,7-8,11-13H,4,6,9-10,14H2,1-3H3,(H2,24,25,26)/b27-21- |
| InChIKey | WSOXHBCSHDPTMD-MEFGMAGPSA-N |
| XLogP | 4.50 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|