C22H23N5O3S — CID 145045262
N-[4-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2,4-thiadiazol-5-yl]oxy]-2,5-dimethylphenyl]-1,4,5,6-tetrahydropyrimidin-2-amine (PubChem CID 145045262) has the molecular formula C22H23N5O3S and a molecular weight of 437.53 g/mol. Its IUPAC name is N-[4-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2,4-thiadiazol-5-yl]oxy]-2,5-dimethylphenyl]-1,4,5,6-tetrahydropyrimidin-2-amine.
| Compound Name | N-[4-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2,4-thiadiazol-5-yl]oxy]-2,5-dimethylphenyl]-1,4,5,6-tetrahydropyrimidin-2-amine |
|---|---|
| PubChem CID | 145045262 |
| Molecular Formula | C22H23N5O3S |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | N-[4-[[3-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,2,4-thiadiazol-5-yl]oxy]-2,5-dimethylphenyl]-1,4,5,6-tetrahydropyrimidin-2-amine |
| SMILES | Cc1cc(Oc2nc(-c3ccc4c(c3)OCCO4)ns2)c(C)cc1NC1=NCCCN1 |
| InChI | InChI=1S/C22H23N5O3S/c1-13-11-18(14(2)10-16(13)25-21-23-6-3-7-24-21)30-22-26-20(27-31-22)15-4-5-17-19(12-15)29-9-8-28-17/h4-5,10-12H,3,6-9H2,1-2H3,(H2,23,24,25) |
| InChIKey | YBINJYYEKIKONI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 89.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |