About 1-methyl-N-[(2Z)-penta-2,4-dien-2-yl]pyridin-2-imine
1-methyl-N-[(2Z)-penta-2,4-dien-2-yl]pyridin-2-imine (PubChem CID 145045370) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is 1-methyl-N-[(2Z)-penta-2,4-dien-2-yl]pyridin-2-imine.
Molecular Properties
| Compound Name | 1-methyl-N-[(2Z)-penta-2,4-dien-2-yl]pyridin-2-imine |
| PubChem CID | 145045370 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 1-methyl-N-[(2Z)-penta-2,4-dien-2-yl]pyridin-2-imine |
| SMILES | C=C/C=C(C)\N=c1/ccccn1C |
| InChI | InChI=1S/C11H14N2/c1-4-7-10(2)12-11-8-5-6-9-13(11)3/h4-9H,1H2,2-3H3/b10-7-,12-11+ |
| InChIKey | WXMVQKJPWZBREE-UPXUIUAPSA-N |
| XLogP | 2.02 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-N-[(2Z)-penta-2,4-dien-2-yl]pyridin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-N-[(2Z)-penta-2,4-dien-2-yl]pyridin-2-imine?
The IUPAC name of 1-methyl-N-[(2Z)-penta-2,4-dien-2-yl]pyridin-2-imine (CID 145045370) is 1-methyl-N-[(2Z)-penta-2,4-dien-2-yl]pyridin-2-imine.
What is the SMILES notation for 1-methyl-N-[(2Z)-penta-2,4-dien-2-yl]pyridin-2-imine?
The canonical SMILES for 1-methyl-N-[(2Z)-penta-2,4-dien-2-yl]pyridin-2-imine is C=C/C=C(C)\N=c1/ccccn1C.
What is the InChIKey of 1-methyl-N-[(2Z)-penta-2,4-dien-2-yl]pyridin-2-imine?
The InChIKey is WXMVQKJPWZBREE-UPXUIUAPSA-N. The full InChI is InChI=1S/C11H14N2/c1-4-7-10(2)12-11-8-5-6-9-13(11)3/h4-9H,1H2,2-3H3/b10-7-,12-11+.
What are the key properties of 1-methyl-N-[(2Z)-penta-2,4-dien-2-yl]pyridin-2-imine?
1-methyl-N-[(2Z)-penta-2,4-dien-2-yl]pyridin-2-imine has a molecular weight of 174.25 g/mol, XLogP of 2.02, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-N-[(2Z)-penta-2,4-dien-2-yl]pyridin-2-imine is sourced from PubChem (CID 145045370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).