C22H25F3N4O4 — CID 145045375
ethane;2-(2-methoxyethoxy)-5-[[2-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]-3-pyridinyl]methoxy]pyridine-4-carbaldehyde (PubChem CID 145045375) has the molecular formula C22H25F3N4O4 and a molecular weight of 466.46 g/mol. Its IUPAC name is ethane;2-(2-methoxyethoxy)-5-[[2-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]-3-pyridinyl]methoxy]pyridine-4-carbaldehyde.
| Compound Name | ethane;2-(2-methoxyethoxy)-5-[[2-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]-3-pyridinyl]methoxy]pyridine-4-carbaldehyde |
|---|---|
| PubChem CID | 145045375 |
| Molecular Formula | C22H25F3N4O4 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | ethane;2-(2-methoxyethoxy)-5-[[2-[2-(2,2,2-trifluoroethyl)pyrazol-3-yl]-3-pyridinyl]methoxy]pyridine-4-carbaldehyde |
| SMILES | CC.COCCOc1cc(C=O)c(OCc2cccnc2-c2ccnn2CC(F)(F)F)cn1 |
| InChI | InChI=1S/C20H19F3N4O4.C2H6/c1-29-7-8-30-18-9-15(11-28)17(10-25-18)31-12-14-3-2-5-24-19(14)16-4-6-26-27(16)13-20(21,22)23;1-2/h2-6,9-11H,7-8,12-13H2,1H3;1-2H3 |
| InChIKey | QHFHOVLFZSWUDA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 88.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|