About ethane;4-ethenyl-3-methyl-5-[(Z)-prop-1-enyl]-4,5-dihydro-1H-pyrazole
ethane;4-ethenyl-3-methyl-5-[(Z)-prop-1-enyl]-4,5-dihydro-1H-pyrazole (PubChem CID 145045721) has the molecular formula C13H26N2
and a molecular weight of 210.36 g/mol. Its IUPAC name is ethane;4-ethenyl-3-methyl-5-[(Z)-prop-1-enyl]-4,5-dihydro-1H-pyrazole.
Molecular Properties
| Compound Name | ethane;4-ethenyl-3-methyl-5-[(Z)-prop-1-enyl]-4,5-dihydro-1H-pyrazole |
| PubChem CID | 145045721 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | ethane;4-ethenyl-3-methyl-5-[(Z)-prop-1-enyl]-4,5-dihydro-1H-pyrazole |
| SMILES | C=CC1C(C)=NNC1/C=C\C.CC.CC |
| InChI | InChI=1S/C9H14N2.2C2H6/c1-4-6-9-8(5-2)7(3)10-11-9;2*1-2/h4-6,8-9,11H,2H2,1,3H3;2*1-2H3/b6-4-;; |
| InChIKey | XEJCFUZLOMTABL-XFUGJFOESA-N |
| XLogP | 3.76 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-ethenyl-3-methyl-5-[(Z)-prop-1-enyl]-4,5-dihydro-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-ethenyl-3-methyl-5-[(Z)-prop-1-enyl]-4,5-dihydro-1H-pyrazole?
The IUPAC name of ethane;4-ethenyl-3-methyl-5-[(Z)-prop-1-enyl]-4,5-dihydro-1H-pyrazole (CID 145045721) is ethane;4-ethenyl-3-methyl-5-[(Z)-prop-1-enyl]-4,5-dihydro-1H-pyrazole.
What is the SMILES notation for ethane;4-ethenyl-3-methyl-5-[(Z)-prop-1-enyl]-4,5-dihydro-1H-pyrazole?
The canonical SMILES for ethane;4-ethenyl-3-methyl-5-[(Z)-prop-1-enyl]-4,5-dihydro-1H-pyrazole is C=CC1C(C)=NNC1/C=C\C.CC.CC.
What is the InChIKey of ethane;4-ethenyl-3-methyl-5-[(Z)-prop-1-enyl]-4,5-dihydro-1H-pyrazole?
The InChIKey is XEJCFUZLOMTABL-XFUGJFOESA-N. The full InChI is InChI=1S/C9H14N2.2C2H6/c1-4-6-9-8(5-2)7(3)10-11-9;2*1-2/h4-6,8-9,11H,2H2,1,3H3;2*1-2H3/b6-4-;;.
What are the key properties of ethane;4-ethenyl-3-methyl-5-[(Z)-prop-1-enyl]-4,5-dihydro-1H-pyrazole?
ethane;4-ethenyl-3-methyl-5-[(Z)-prop-1-enyl]-4,5-dihydro-1H-pyrazole has a molecular weight of 210.36 g/mol, XLogP of 3.76, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-ethenyl-3-methyl-5-[(Z)-prop-1-enyl]-4,5-dihydro-1H-pyrazole is sourced from PubChem (CID 145045721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).