C25H22BrFN5O7P — CID 145046132
2-amino-9-[2-[[(3-bromophenyl)methoxy-[[5-(4-fluorophenyl)-2-oxo-1,3-dioxol-4-yl]methoxy]phosphanyl]methoxy]ethyl]-1H-purin-6-one (PubChem CID 145046132) has the molecular formula C25H22BrFN5O7P and a molecular weight of 634.36 g/mol. Its IUPAC name is 2-amino-9-[2-[[(3-bromophenyl)methoxy-[[5-(4-fluorophenyl)-2-oxo-1,3-dioxol-4-yl]methoxy]phosphanyl]methoxy]ethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[2-[[(3-bromophenyl)methoxy-[[5-(4-fluorophenyl)-2-oxo-1,3-dioxol-4-yl]methoxy]phosphanyl]methoxy]ethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 145046132 |
| Molecular Formula | C25H22BrFN5O7P |
| Molecular Weight | 634.36 g/mol |
| Exact Mass | 633.04 |
| IUPAC Name | 2-amino-9-[2-[[(3-bromophenyl)methoxy-[[5-(4-fluorophenyl)-2-oxo-1,3-dioxol-4-yl]methoxy]phosphanyl]methoxy]ethyl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2CCOCP(OCc2cccc(Br)c2)OCc2oc(=O)oc2-c2ccc(F)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C25H22BrFN5O7P/c26-17-3-1-2-15(10-17)11-36-40(14-35-9-8-32-13-29-20-22(32)30-24(28)31-23(20)33)37-12-19-21(39-25(34)38-19)16-4-6-18(27)7-5-16/h1-7,10,13H,8-9,11-12,14H2,(H3,28,30,31,33) |
| InChIKey | ASRVMEBWXNHKHA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 160.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.36 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|