C23H20N4O2 — CID 145046684
2-[4-(5-ethyl-2,3-dihydroindol-1-yl)phenoxy]-3H-pyrido[3,4-d]pyrimidin-4-one (PubChem CID 145046684) has the molecular formula C23H20N4O2 and a molecular weight of 384.44 g/mol. Its IUPAC name is 2-[4-(5-ethyl-2,3-dihydroindol-1-yl)phenoxy]-3H-pyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 2-[4-(5-ethyl-2,3-dihydroindol-1-yl)phenoxy]-3H-pyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 145046684 |
| Molecular Formula | C23H20N4O2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 2-[4-(5-ethyl-2,3-dihydroindol-1-yl)phenoxy]-3H-pyrido[3,4-d]pyrimidin-4-one |
| SMILES | CCc1ccc2c(c1)CCN2c1ccc(Oc2nc3cnccc3c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C23H20N4O2/c1-2-15-3-8-21-16(13-15)10-12-27(21)17-4-6-18(7-5-17)29-23-25-20-14-24-11-9-19(20)22(28)26-23/h3-9,11,13-14H,2,10,12H2,1H3,(H,25,26,28) |
| InChIKey | YYIPVBUYENULNY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |