About 4-methoxy-N-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-amine
4-methoxy-N-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-amine (PubChem CID 145047591) has the molecular formula C8H12N4O
and a molecular weight of 180.21 g/mol. Its IUPAC name is 4-methoxy-N-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-amine.
Molecular Properties
| Compound Name | 4-methoxy-N-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-amine |
| PubChem CID | 145047591 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 4-methoxy-N-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-amine |
| SMILES | CNN1Cc2ncnc(OC)c2C1 |
| InChI | InChI=1S/C8H12N4O/c1-9-12-3-6-7(4-12)10-5-11-8(6)13-2/h5,9H,3-4H2,1-2H3 |
| InChIKey | JXOZVUPWNHHDMW-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methoxy-N-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-N-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-amine?
The IUPAC name of 4-methoxy-N-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-amine (CID 145047591) is 4-methoxy-N-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-amine.
What is the SMILES notation for 4-methoxy-N-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-amine?
The canonical SMILES for 4-methoxy-N-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-amine is CNN1Cc2ncnc(OC)c2C1.
What is the InChIKey of 4-methoxy-N-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-amine?
The InChIKey is JXOZVUPWNHHDMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O/c1-9-12-3-6-7(4-12)10-5-11-8(6)13-2/h5,9H,3-4H2,1-2H3.
What are the key properties of 4-methoxy-N-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-amine?
4-methoxy-N-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-amine has a molecular weight of 180.21 g/mol, XLogP of -0.06, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-N-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-amine is sourced from PubChem (CID 145047591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).