About ethane;2-methoxy-6-methyl-5,7-dihydropyrrolo[3,4-b]pyridine
ethane;2-methoxy-6-methyl-5,7-dihydropyrrolo[3,4-b]pyridine (PubChem CID 145047599) has the molecular formula C13H24N2O
and a molecular weight of 224.35 g/mol. Its IUPAC name is ethane;2-methoxy-6-methyl-5,7-dihydropyrrolo[3,4-b]pyridine.
Molecular Properties
| Compound Name | ethane;2-methoxy-6-methyl-5,7-dihydropyrrolo[3,4-b]pyridine |
| PubChem CID | 145047599 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | ethane;2-methoxy-6-methyl-5,7-dihydropyrrolo[3,4-b]pyridine |
| SMILES | CC.CC.COc1ccc2c(n1)CN(C)C2 |
| InChI | InChI=1S/C9H12N2O.2C2H6/c1-11-5-7-3-4-9(12-2)10-8(7)6-11;2*1-2/h3-4H,5-6H2,1-2H3;2*1-2H3 |
| InChIKey | BFLNRVLKEVKLOA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-methoxy-6-methyl-5,7-dihydropyrrolo[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methoxy-6-methyl-5,7-dihydropyrrolo[3,4-b]pyridine?
The IUPAC name of ethane;2-methoxy-6-methyl-5,7-dihydropyrrolo[3,4-b]pyridine (CID 145047599) is ethane;2-methoxy-6-methyl-5,7-dihydropyrrolo[3,4-b]pyridine.
What is the SMILES notation for ethane;2-methoxy-6-methyl-5,7-dihydropyrrolo[3,4-b]pyridine?
The canonical SMILES for ethane;2-methoxy-6-methyl-5,7-dihydropyrrolo[3,4-b]pyridine is CC.CC.COc1ccc2c(n1)CN(C)C2.
What is the InChIKey of ethane;2-methoxy-6-methyl-5,7-dihydropyrrolo[3,4-b]pyridine?
The InChIKey is BFLNRVLKEVKLOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O.2C2H6/c1-11-5-7-3-4-9(12-2)10-8(7)6-11;2*1-2/h3-4H,5-6H2,1-2H3;2*1-2H3.
What are the key properties of ethane;2-methoxy-6-methyl-5,7-dihydropyrrolo[3,4-b]pyridine?
ethane;2-methoxy-6-methyl-5,7-dihydropyrrolo[3,4-b]pyridine has a molecular weight of 224.35 g/mol, XLogP of 3.09, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methoxy-6-methyl-5,7-dihydropyrrolo[3,4-b]pyridine is sourced from PubChem (CID 145047599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).