About ethane;4-methoxy-6-methyl-5,7-dihydropyrrolo[3,4-b]pyridine
ethane;4-methoxy-6-methyl-5,7-dihydropyrrolo[3,4-b]pyridine (PubChem CID 145047633) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is ethane;4-methoxy-6-methyl-5,7-dihydropyrrolo[3,4-b]pyridine.
Molecular Properties
| Compound Name | ethane;4-methoxy-6-methyl-5,7-dihydropyrrolo[3,4-b]pyridine |
| PubChem CID | 145047633 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | ethane;4-methoxy-6-methyl-5,7-dihydropyrrolo[3,4-b]pyridine |
| SMILES | CC.COc1ccnc2c1CN(C)C2 |
| InChI | InChI=1S/C9H12N2O.C2H6/c1-11-5-7-8(6-11)10-4-3-9(7)12-2;1-2/h3-4H,5-6H2,1-2H3;1-2H3 |
| InChIKey | GAHHHTYWULOMOO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;4-methoxy-6-methyl-5,7-dihydropyrrolo[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methoxy-6-methyl-5,7-dihydropyrrolo[3,4-b]pyridine?
The IUPAC name of ethane;4-methoxy-6-methyl-5,7-dihydropyrrolo[3,4-b]pyridine (CID 145047633) is ethane;4-methoxy-6-methyl-5,7-dihydropyrrolo[3,4-b]pyridine.
What is the SMILES notation for ethane;4-methoxy-6-methyl-5,7-dihydropyrrolo[3,4-b]pyridine?
The canonical SMILES for ethane;4-methoxy-6-methyl-5,7-dihydropyrrolo[3,4-b]pyridine is CC.COc1ccnc2c1CN(C)C2.
What is the InChIKey of ethane;4-methoxy-6-methyl-5,7-dihydropyrrolo[3,4-b]pyridine?
The InChIKey is GAHHHTYWULOMOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O.C2H6/c1-11-5-7-8(6-11)10-4-3-9(7)12-2;1-2/h3-4H,5-6H2,1-2H3;1-2H3.
What are the key properties of ethane;4-methoxy-6-methyl-5,7-dihydropyrrolo[3,4-b]pyridine?
ethane;4-methoxy-6-methyl-5,7-dihydropyrrolo[3,4-b]pyridine has a molecular weight of 194.28 g/mol, XLogP of 2.06, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methoxy-6-methyl-5,7-dihydropyrrolo[3,4-b]pyridine is sourced from PubChem (CID 145047633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).