C21H41N5O — CID 145047927
N'-[[5-(4,4-dimethylcyclohexyl)-1H-pyrazol-4-yl]methyl]-N'-methylethane-1,2-diamine;N-(3-methylbutyl)formamide (PubChem CID 145047927) has the molecular formula C21H41N5O and a molecular weight of 379.59 g/mol. Its IUPAC name is N'-[[5-(4,4-dimethylcyclohexyl)-1H-pyrazol-4-yl]methyl]-N'-methylethane-1,2-diamine;N-(3-methylbutyl)formamide.
| Compound Name | N'-[[5-(4,4-dimethylcyclohexyl)-1H-pyrazol-4-yl]methyl]-N'-methylethane-1,2-diamine;N-(3-methylbutyl)formamide |
|---|---|
| PubChem CID | 145047927 |
| Molecular Formula | C21H41N5O |
| Molecular Weight | 379.59 g/mol |
| Exact Mass | 379.33 |
| IUPAC Name | N'-[[5-(4,4-dimethylcyclohexyl)-1H-pyrazol-4-yl]methyl]-N'-methylethane-1,2-diamine;N-(3-methylbutyl)formamide |
| SMILES | CC(C)CCNC=O.CN(CCN)Cc1cn[nH]c1C1CCC(C)(C)CC1 |
| InChI | InChI=1S/C15H28N4.C6H13NO/c1-15(2)6-4-12(5-7-15)14-13(10-17-18-14)11-19(3)9-8-16;1-6(2)3-4-7-5-8/h10,12H,4-9,11,16H2,1-3H3,(H,17,18);5-6H,3-4H2,1-2H3,(H,7,8) |
| InChIKey | FLVYPGPNJBQAON-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.59 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|