C20H13ClFN5O5S2 — CID 145048263
3-[3-[5-[(5-chlorothiophen-2-yl)methylamino]-1-(1,3-thiazole-2-carbonyl)pyrazol-3-yl]-6-fluoro-2-oxo-1-pyridinyl]-2-oxopropanoic acid (PubChem CID 145048263) has the molecular formula C20H13ClFN5O5S2 and a molecular weight of 521.94 g/mol. Its IUPAC name is 3-[3-[5-[(5-chlorothiophen-2-yl)methylamino]-1-(1,3-thiazole-2-carbonyl)pyrazol-3-yl]-6-fluoro-2-oxo-1-pyridinyl]-2-oxopropanoic acid.
| Compound Name | 3-[3-[5-[(5-chlorothiophen-2-yl)methylamino]-1-(1,3-thiazole-2-carbonyl)pyrazol-3-yl]-6-fluoro-2-oxo-1-pyridinyl]-2-oxopropanoic acid |
|---|---|
| PubChem CID | 145048263 |
| Molecular Formula | C20H13ClFN5O5S2 |
| Molecular Weight | 521.94 g/mol |
| Exact Mass | 521.00 |
| IUPAC Name | 3-[3-[5-[(5-chlorothiophen-2-yl)methylamino]-1-(1,3-thiazole-2-carbonyl)pyrazol-3-yl]-6-fluoro-2-oxo-1-pyridinyl]-2-oxopropanoic acid |
| SMILES | O=C(O)C(=O)Cn1c(F)ccc(-c2cc(NCc3ccc(Cl)s3)n(C(=O)c3nccs3)n2)c1=O |
| InChI | InChI=1S/C20H13ClFN5O5S2/c21-14-3-1-10(34-14)8-24-16-7-12(25-27(16)19(30)17-23-5-6-33-17)11-2-4-15(22)26(18(11)29)9-13(28)20(31)32/h1-7,24H,8-9H2,(H,31,32) |
| InChIKey | DADZRCSCLXXLHV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 136.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.94 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|