About 4-bromo-3-nitro-1-(3,3,3-trifluoropropyl)pyrazole;ethane
4-bromo-3-nitro-1-(3,3,3-trifluoropropyl)pyrazole;ethane (PubChem CID 145048499) has the molecular formula C8H11BrF3N3O2
and a molecular weight of 318.09 g/mol. Its IUPAC name is 4-bromo-3-nitro-1-(3,3,3-trifluoropropyl)pyrazole;ethane.
Molecular Properties
| Compound Name | 4-bromo-3-nitro-1-(3,3,3-trifluoropropyl)pyrazole;ethane |
| PubChem CID | 145048499 |
| Molecular Formula | C8H11BrF3N3O2 |
| Molecular Weight | 318.09 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | 4-bromo-3-nitro-1-(3,3,3-trifluoropropyl)pyrazole;ethane |
| SMILES | CC.O=[N+]([O-])c1nn(CCC(F)(F)F)cc1Br |
| InChI | InChI=1S/C6H5BrF3N3O2.C2H6/c7-4-3-12(2-1-6(8,9)10)11-5(4)13(14)15;1-2/h3H,1-2H2;1-2H3 |
| InChIKey | KTPMCSJBUTZFOD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.09 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-3-nitro-1-(3,3,3-trifluoropropyl)pyrazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3-nitro-1-(3,3,3-trifluoropropyl)pyrazole;ethane?
The IUPAC name of 4-bromo-3-nitro-1-(3,3,3-trifluoropropyl)pyrazole;ethane (CID 145048499) is 4-bromo-3-nitro-1-(3,3,3-trifluoropropyl)pyrazole;ethane.
What is the SMILES notation for 4-bromo-3-nitro-1-(3,3,3-trifluoropropyl)pyrazole;ethane?
The canonical SMILES for 4-bromo-3-nitro-1-(3,3,3-trifluoropropyl)pyrazole;ethane is CC.O=[N+]([O-])c1nn(CCC(F)(F)F)cc1Br.
What is the InChIKey of 4-bromo-3-nitro-1-(3,3,3-trifluoropropyl)pyrazole;ethane?
The InChIKey is KTPMCSJBUTZFOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BrF3N3O2.C2H6/c7-4-3-12(2-1-6(8,9)10)11-5(4)13(14)15;1-2/h3H,1-2H2;1-2H3.
What are the key properties of 4-bromo-3-nitro-1-(3,3,3-trifluoropropyl)pyrazole;ethane?
4-bromo-3-nitro-1-(3,3,3-trifluoropropyl)pyrazole;ethane has a molecular weight of 318.09 g/mol, XLogP of 3.53, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3-nitro-1-(3,3,3-trifluoropropyl)pyrazole;ethane is sourced from PubChem (CID 145048499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).