About 5-methyl-3-nitro-1,4-diphenylpyrazole
5-methyl-3-nitro-1,4-diphenylpyrazole (PubChem CID 145048719) has the molecular formula C16H13N3O2
and a molecular weight of 279.30 g/mol. Its IUPAC name is 5-methyl-3-nitro-1,4-diphenylpyrazole.
Molecular Properties
| Compound Name | 5-methyl-3-nitro-1,4-diphenylpyrazole |
| PubChem CID | 145048719 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 5-methyl-3-nitro-1,4-diphenylpyrazole |
| SMILES | Cc1c(-c2ccccc2)c([N+](=O)[O-])nn1-c1ccccc1 |
| InChI | InChI=1S/C16H13N3O2/c1-12-15(13-8-4-2-5-9-13)16(19(20)21)17-18(12)14-10-6-3-7-11-14/h2-11H,1H3 |
| InChIKey | MFVKQXBIYLKQBY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-3-nitro-1,4-diphenylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-nitro-1,4-diphenylpyrazole?
The IUPAC name of 5-methyl-3-nitro-1,4-diphenylpyrazole (CID 145048719) is 5-methyl-3-nitro-1,4-diphenylpyrazole.
What is the SMILES notation for 5-methyl-3-nitro-1,4-diphenylpyrazole?
The canonical SMILES for 5-methyl-3-nitro-1,4-diphenylpyrazole is Cc1c(-c2ccccc2)c([N+](=O)[O-])nn1-c1ccccc1.
What is the InChIKey of 5-methyl-3-nitro-1,4-diphenylpyrazole?
The InChIKey is MFVKQXBIYLKQBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3O2/c1-12-15(13-8-4-2-5-9-13)16(19(20)21)17-18(12)14-10-6-3-7-11-14/h2-11H,1H3.
What are the key properties of 5-methyl-3-nitro-1,4-diphenylpyrazole?
5-methyl-3-nitro-1,4-diphenylpyrazole has a molecular weight of 279.30 g/mol, XLogP of 3.76, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-nitro-1,4-diphenylpyrazole is sourced from PubChem (CID 145048719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).