C24H29Cl2N3O3 — CID 145048892
4-chloro-5-(2-chlorophenyl)-2-hydroxybenzaldehyde;(E)-4-(dimethylamino)-1-(4-methylpiperazin-1-yl)but-2-en-1-one (PubChem CID 145048892) has the molecular formula C24H29Cl2N3O3 and a molecular weight of 478.42 g/mol. Its IUPAC name is 4-chloro-5-(2-chlorophenyl)-2-hydroxybenzaldehyde;(E)-4-(dimethylamino)-1-(4-methylpiperazin-1-yl)but-2-en-1-one.
| Compound Name | 4-chloro-5-(2-chlorophenyl)-2-hydroxybenzaldehyde;(E)-4-(dimethylamino)-1-(4-methylpiperazin-1-yl)but-2-en-1-one |
|---|---|
| PubChem CID | 145048892 |
| Molecular Formula | C24H29Cl2N3O3 |
| Molecular Weight | 478.42 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 4-chloro-5-(2-chlorophenyl)-2-hydroxybenzaldehyde;(E)-4-(dimethylamino)-1-(4-methylpiperazin-1-yl)but-2-en-1-one |
| SMILES | CN(C)C/C=C/C(=O)N1CCN(C)CC1.O=Cc1cc(-c2ccccc2Cl)c(Cl)cc1O |
| InChI | InChI=1S/C13H8Cl2O2.C11H21N3O/c14-11-4-2-1-3-9(11)10-5-8(7-16)13(17)6-12(10)15;1-12(2)6-4-5-11(15)14-9-7-13(3)8-10-14/h1-7,17H;4-5H,6-10H2,1-3H3/b;5-4+ |
| InChIKey | AXLVJOKIBKOXAB-RCKHEGBHSA-N |
| XLogP | 4.06 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|