C24H33N5 — CID 145049285
3-[5-[6-(2,5-dimethylpyrrol-1-yl)-2-pyridinyl]pyrazin-2-yl]-3-azabicyclo[3.1.0]hexane;methane;propane (PubChem CID 145049285) has the molecular formula C24H33N5 and a molecular weight of 391.56 g/mol. Its IUPAC name is 3-[5-[6-(2,5-dimethylpyrrol-1-yl)-2-pyridinyl]pyrazin-2-yl]-3-azabicyclo[3.1.0]hexane;methane;propane.
| Compound Name | 3-[5-[6-(2,5-dimethylpyrrol-1-yl)-2-pyridinyl]pyrazin-2-yl]-3-azabicyclo[3.1.0]hexane;methane;propane |
|---|---|
| PubChem CID | 145049285 |
| Molecular Formula | C24H33N5 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | 3-[5-[6-(2,5-dimethylpyrrol-1-yl)-2-pyridinyl]pyrazin-2-yl]-3-azabicyclo[3.1.0]hexane;methane;propane |
| SMILES | C.CCC.Cc1ccc(C)n1-c1cccc(-c2cnc(N3CC4CC4C3)cn2)n1 |
| InChI | InChI=1S/C20H21N5.C3H8.CH4/c1-13-6-7-14(2)25(13)19-5-3-4-17(23-19)18-9-22-20(10-21-18)24-11-15-8-16(15)12-24;1-3-2;/h3-7,9-10,15-16H,8,11-12H2,1-2H3;3H2,1-2H3;1H4 |
| InChIKey | ROCHEWVOUSKSIO-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|